C18H30N4O2 — CID 133499466
tert-butyl (2R)-4-(2-tert-butylpyrimidin-4-yl)-2-methylpiperazine-1-carboxylate (PubChem CID 133499466) has the molecular formula C18H30N4O2 and a molecular weight of 334.46 g/mol. Its IUPAC name is tert-butyl (2R)-4-(2-tert-butylpyrimidin-4-yl)-2-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2R)-4-(2-tert-butylpyrimidin-4-yl)-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 133499466 |
| Molecular Formula | C18H30N4O2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | tert-butyl (2R)-4-(2-tert-butylpyrimidin-4-yl)-2-methylpiperazine-1-carboxylate |
| SMILES | C[C@@H]1CN(c2ccnc(C(C)(C)C)n2)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H30N4O2/c1-13-12-21(10-11-22(13)16(23)24-18(5,6)7)14-8-9-19-15(20-14)17(2,3)4/h8-9,13H,10-12H2,1-7H3/t13-/m1/s1 |
| InChIKey | KRSFFICTEGSDLM-CYBMUJFWSA-N |
| XLogP | 3.22 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |