C16H22N4O2 — CID 97176975
tert-butyl (2R)-4-(4-cyano-2-pyridinyl)-2-methylpiperazine-1-carboxylate (PubChem CID 97176975) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is tert-butyl (2R)-4-(4-cyano-2-pyridinyl)-2-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2R)-4-(4-cyano-2-pyridinyl)-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 97176975 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | tert-butyl (2R)-4-(4-cyano-2-pyridinyl)-2-methylpiperazine-1-carboxylate |
| SMILES | C[C@@H]1CN(c2cc(C#N)ccn2)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H22N4O2/c1-12-11-19(14-9-13(10-17)5-6-18-14)7-8-20(12)15(21)22-16(2,3)4/h5-6,9,12H,7-8,11H2,1-4H3/t12-/m1/s1 |
| InChIKey | ILHPNZINGUFSNH-GFCCVEGCSA-N |
| XLogP | 2.40 |
| TPSA | 69.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |