C17H23N3O2 — CID 134515533
tert-butyl (2S)-4-(3-cyanophenyl)-2-methylpiperazine-1-carboxylate (PubChem CID 134515533) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is tert-butyl (2S)-4-(3-cyanophenyl)-2-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2S)-4-(3-cyanophenyl)-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 134515533 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | tert-butyl (2S)-4-(3-cyanophenyl)-2-methylpiperazine-1-carboxylate |
| SMILES | C[C@H]1CN(c2cccc(C#N)c2)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H23N3O2/c1-13-12-19(15-7-5-6-14(10-15)11-18)8-9-20(13)16(21)22-17(2,3)4/h5-7,10,13H,8-9,12H2,1-4H3/t13-/m0/s1 |
| InChIKey | JQNHAJDHTXVSSX-ZDUSSCGKSA-N |
| XLogP | 3.00 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |