C18H24BrN3O2 — CID 172914604
tert-butyl 4-(5-bromo-4-cyano-2-methylphenyl)-2-methylpiperazine-1-carboxylate (PubChem CID 172914604) has the molecular formula C18H24BrN3O2 and a molecular weight of 394.31 g/mol. Its IUPAC name is tert-butyl 4-(5-bromo-4-cyano-2-methylphenyl)-2-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(5-bromo-4-cyano-2-methylphenyl)-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 172914604 |
| Molecular Formula | C18H24BrN3O2 |
| Molecular Weight | 394.31 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | tert-butyl 4-(5-bromo-4-cyano-2-methylphenyl)-2-methylpiperazine-1-carboxylate |
| SMILES | Cc1cc(C#N)c(Br)cc1N1CCN(C(=O)OC(C)(C)C)C(C)C1 |
| InChI | InChI=1S/C18H24BrN3O2/c1-12-8-14(10-20)15(19)9-16(12)21-6-7-22(13(2)11-21)17(23)24-18(3,4)5/h8-9,13H,6-7,11H2,1-5H3 |
| InChIKey | UPSQRDCVQVCORC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.31 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |