C28H35BrN4O3 — CID 134513708
tert-butyl N-[3-[4-bromo-2-[(2R)-4-(2-cyanophenyl)-2-methylpiperazine-1-carbonyl]-5-methylphenyl]propyl]carbamate (PubChem CID 134513708) has the molecular formula C28H35BrN4O3 and a molecular weight of 555.52 g/mol. Its IUPAC name is tert-butyl N-[3-[4-bromo-2-[(2R)-4-(2-cyanophenyl)-2-methylpiperazine-1-carbonyl]-5-methylphenyl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-bromo-2-[(2R)-4-(2-cyanophenyl)-2-methylpiperazine-1-carbonyl]-5-methylphenyl]propyl]carbamate |
|---|---|
| PubChem CID | 134513708 |
| Molecular Formula | C28H35BrN4O3 |
| Molecular Weight | 555.52 g/mol |
| Exact Mass | 554.19 |
| IUPAC Name | tert-butyl N-[3-[4-bromo-2-[(2R)-4-(2-cyanophenyl)-2-methylpiperazine-1-carbonyl]-5-methylphenyl]propyl]carbamate |
| SMILES | Cc1cc(CCCNC(=O)OC(C)(C)C)c(C(=O)N2CCN(c3ccccc3C#N)C[C@H]2C)cc1Br |
| InChI | InChI=1S/C28H35BrN4O3/c1-19-15-21(10-8-12-31-27(35)36-28(3,4)5)23(16-24(19)29)26(34)33-14-13-32(18-20(33)2)25-11-7-6-9-22(25)17-30/h6-7,9,11,15-16,20H,8,10,12-14,18H2,1-5H3,(H,31,35)/t20-/m1/s1 |
| InChIKey | XRYIDWVFNQYMDD-HXUWFJFHSA-N |
| XLogP | 5.44 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.52 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|