C39H50N6O4 — CID 134513863
tert-butyl N-[3-[2-[4-[5-[[4-(2-cyanophenyl)piperazin-1-yl]methyl]-2,4-dimethylbenzoyl]piperazin-1-yl]phenyl]propyl]-N-hydroxycarbamate (PubChem CID 134513863) has the molecular formula C39H50N6O4 and a molecular weight of 666.87 g/mol. Its IUPAC name is tert-butyl N-[3-[2-[4-[5-[[4-(2-cyanophenyl)piperazin-1-yl]methyl]-2,4-dimethylbenzoyl]piperazin-1-yl]phenyl]propyl]-N-hydroxycarbamate.
| Compound Name | tert-butyl N-[3-[2-[4-[5-[[4-(2-cyanophenyl)piperazin-1-yl]methyl]-2,4-dimethylbenzoyl]piperazin-1-yl]phenyl]propyl]-N-hydroxycarbamate |
|---|---|
| PubChem CID | 134513863 |
| Molecular Formula | C39H50N6O4 |
| Molecular Weight | 666.87 g/mol |
| Exact Mass | 666.39 |
| IUPAC Name | tert-butyl N-[3-[2-[4-[5-[[4-(2-cyanophenyl)piperazin-1-yl]methyl]-2,4-dimethylbenzoyl]piperazin-1-yl]phenyl]propyl]-N-hydroxycarbamate |
| SMILES | Cc1cc(C)c(C(=O)N2CCN(c3ccccc3CCCN(O)C(=O)OC(C)(C)C)CC2)cc1CN1CCN(c2ccccc2C#N)CC1 |
| InChI | InChI=1S/C39H50N6O4/c1-29-25-30(2)34(26-33(29)28-41-17-19-42(20-18-41)36-15-9-7-12-32(36)27-40)37(46)44-23-21-43(22-24-44)35-14-8-6-11-31(35)13-10-16-45(48)38(47)49-39(3,4)5/h6-9,11-12,14-15,25-26,48H,10,13,16-24,28H2,1-5H3 |
| InChIKey | DDOWXKPQGSAOCC-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.87 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|