C22H25N3O2 — CID 134498915
5-[2-[4-(2-cyanophenyl)piperazin-1-yl]ethyl]-2,4-dimethylbenzoic acid (PubChem CID 134498915) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is 5-[2-[4-(2-cyanophenyl)piperazin-1-yl]ethyl]-2,4-dimethylbenzoic acid.
| Compound Name | 5-[2-[4-(2-cyanophenyl)piperazin-1-yl]ethyl]-2,4-dimethylbenzoic acid |
|---|---|
| PubChem CID | 134498915 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 5-[2-[4-(2-cyanophenyl)piperazin-1-yl]ethyl]-2,4-dimethylbenzoic acid |
| SMILES | Cc1cc(C)c(C(=O)O)cc1CCN1CCN(c2ccccc2C#N)CC1 |
| InChI | InChI=1S/C22H25N3O2/c1-16-13-17(2)20(22(26)27)14-18(16)7-8-24-9-11-25(12-10-24)21-6-4-3-5-19(21)15-23/h3-6,13-14H,7-12H2,1-2H3,(H,26,27) |
| InChIKey | UEPUDNJACAVHJY-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |