C17H23N3O2 — CID 69145059
6-[4-(2-cyanophenyl)piperazin-1-yl]hexanoic acid (PubChem CID 69145059) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 6-[4-(2-cyanophenyl)piperazin-1-yl]hexanoic acid.
| Compound Name | 6-[4-(2-cyanophenyl)piperazin-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 69145059 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 6-[4-(2-cyanophenyl)piperazin-1-yl]hexanoic acid |
| SMILES | N#Cc1ccccc1N1CCN(CCCCCC(=O)O)CC1 |
| InChI | InChI=1S/C17H23N3O2/c18-14-15-6-3-4-7-16(15)20-12-10-19(11-13-20)9-5-1-2-8-17(21)22/h3-4,6-7H,1-2,5,8-13H2,(H,21,22) |
| InChIKey | NKFGLHTZUIXSFW-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|