C19H17Cl2N3O2 — CID 134499021
2,4-dichloro-5-[[4-(2-cyanophenyl)piperazin-1-yl]methyl]benzoic acid (PubChem CID 134499021) has the molecular formula C19H17Cl2N3O2 and a molecular weight of 390.27 g/mol. Its IUPAC name is 2,4-dichloro-5-[[4-(2-cyanophenyl)piperazin-1-yl]methyl]benzoic acid.
| Compound Name | 2,4-dichloro-5-[[4-(2-cyanophenyl)piperazin-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 134499021 |
| Molecular Formula | C19H17Cl2N3O2 |
| Molecular Weight | 390.27 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | 2,4-dichloro-5-[[4-(2-cyanophenyl)piperazin-1-yl]methyl]benzoic acid |
| SMILES | N#Cc1ccccc1N1CCN(Cc2cc(C(=O)O)c(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C19H17Cl2N3O2/c20-16-10-17(21)15(19(25)26)9-14(16)12-23-5-7-24(8-6-23)18-4-2-1-3-13(18)11-22/h1-4,9-10H,5-8,12H2,(H,25,26) |
| InChIKey | WPKFKBWWWBMVOF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.27 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |