C16H23N3O2 — CID 130270935
tert-butyl N-[3-(4-amino-2-cyano-5-methylphenyl)propyl]carbamate (PubChem CID 130270935) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is tert-butyl N-[3-(4-amino-2-cyano-5-methylphenyl)propyl]carbamate.
| Compound Name | tert-butyl N-[3-(4-amino-2-cyano-5-methylphenyl)propyl]carbamate |
|---|---|
| PubChem CID | 130270935 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | tert-butyl N-[3-(4-amino-2-cyano-5-methylphenyl)propyl]carbamate |
| SMILES | Cc1cc(CCCNC(=O)OC(C)(C)C)c(C#N)cc1N |
| InChI | InChI=1S/C16H23N3O2/c1-11-8-12(13(10-17)9-14(11)18)6-5-7-19-15(20)21-16(2,3)4/h8-9H,5-7,18H2,1-4H3,(H,19,20) |
| InChIKey | FLWALNWFRYSWLJ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|