C22H38N4O4 — CID 143983002
tert-butyl N-[3-[2,5-diamino-3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]phenyl]propyl]carbamate (PubChem CID 143983002) has the molecular formula C22H38N4O4 and a molecular weight of 422.57 g/mol. Its IUPAC name is tert-butyl N-[3-[2,5-diamino-3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]phenyl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[2,5-diamino-3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]phenyl]propyl]carbamate |
|---|---|
| PubChem CID | 143983002 |
| Molecular Formula | C22H38N4O4 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | tert-butyl N-[3-[2,5-diamino-3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]phenyl]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCc1cc(N)cc(CCCNC(=O)OC(C)(C)C)c1N |
| InChI | InChI=1S/C22H38N4O4/c1-21(2,3)29-19(27)25-11-7-9-15-13-17(23)14-16(18(15)24)10-8-12-26-20(28)30-22(4,5)6/h13-14H,7-12,23-24H2,1-6H3,(H,25,27)(H,26,28) |
| InChIKey | GQCLCZGGMGYTPQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|