C29H40F3N3O5 — CID 158196920
tert-butyl N-[3-[3-[4-amino-2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]phenoxy]-5-(trifluoromethyl)phenyl]propyl]carbamate (PubChem CID 158196920) has the molecular formula C29H40F3N3O5 and a molecular weight of 567.65 g/mol. Its IUPAC name is tert-butyl N-[3-[3-[4-amino-2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]phenoxy]-5-(trifluoromethyl)phenyl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-[4-amino-2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]phenoxy]-5-(trifluoromethyl)phenyl]propyl]carbamate |
|---|---|
| PubChem CID | 158196920 |
| Molecular Formula | C29H40F3N3O5 |
| Molecular Weight | 567.65 g/mol |
| Exact Mass | 567.29 |
| IUPAC Name | tert-butyl N-[3-[3-[4-amino-2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]phenoxy]-5-(trifluoromethyl)phenyl]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCc1cc(Oc2ccc(N)cc2CCCNC(=O)OC(C)(C)C)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C29H40F3N3O5/c1-27(2,3)39-25(36)34-13-7-9-19-15-21(29(30,31)32)18-23(16-19)38-24-12-11-22(33)17-20(24)10-8-14-35-26(37)40-28(4,5)6/h11-12,15-18H,7-10,13-14,33H2,1-6H3,(H,34,36)(H,35,37) |
| InChIKey | IZQYGSMAMBIODQ-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.65 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|