C22H27F3N2O3 — CID 123384327
tert-butyl N-[3-[5-amino-2-[3-methyl-5-(trifluoromethyl)phenoxy]phenyl]propyl]carbamate (PubChem CID 123384327) has the molecular formula C22H27F3N2O3 and a molecular weight of 424.46 g/mol. Its IUPAC name is tert-butyl N-[3-[5-amino-2-[3-methyl-5-(trifluoromethyl)phenoxy]phenyl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[5-amino-2-[3-methyl-5-(trifluoromethyl)phenoxy]phenyl]propyl]carbamate |
|---|---|
| PubChem CID | 123384327 |
| Molecular Formula | C22H27F3N2O3 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | tert-butyl N-[3-[5-amino-2-[3-methyl-5-(trifluoromethyl)phenoxy]phenyl]propyl]carbamate |
| SMILES | Cc1cc(Oc2ccc(N)cc2CCCNC(=O)OC(C)(C)C)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H27F3N2O3/c1-14-10-16(22(23,24)25)13-18(11-14)29-19-8-7-17(26)12-15(19)6-5-9-27-20(28)30-21(2,3)4/h7-8,10-13H,5-6,9,26H2,1-4H3,(H,27,28) |
| InChIKey | RJBWJGZOYIRSQW-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|