C16H21BrF2N2O2 — CID 178100462
tert-butyl (2R)-4-(4-bromo-2,5-difluorophenyl)-2-methylpiperazine-1-carboxylate (PubChem CID 178100462) has the molecular formula C16H21BrF2N2O2 and a molecular weight of 391.26 g/mol. Its IUPAC name is tert-butyl (2R)-4-(4-bromo-2,5-difluorophenyl)-2-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2R)-4-(4-bromo-2,5-difluorophenyl)-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 178100462 |
| Molecular Formula | C16H21BrF2N2O2 |
| Molecular Weight | 391.26 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | tert-butyl (2R)-4-(4-bromo-2,5-difluorophenyl)-2-methylpiperazine-1-carboxylate |
| SMILES | C[C@@H]1CN(c2cc(F)c(Br)cc2F)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H21BrF2N2O2/c1-10-9-20(14-8-12(18)11(17)7-13(14)19)5-6-21(10)15(22)23-16(2,3)4/h7-8,10H,5-6,9H2,1-4H3/t10-/m1/s1 |
| InChIKey | WNCULAFICBBUHA-SNVBAGLBSA-N |
| XLogP | 4.17 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.26 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|