C16H21BrF2N2O3 — CID 175981019
tert-butyl (3S)-4-(4-bromo-2,5-difluorophenyl)-3-(hydroxymethyl)piperazine-1-carboxylate (PubChem CID 175981019) has the molecular formula C16H21BrF2N2O3 and a molecular weight of 407.26 g/mol. Its IUPAC name is tert-butyl (3S)-4-(4-bromo-2,5-difluorophenyl)-3-(hydroxymethyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl (3S)-4-(4-bromo-2,5-difluorophenyl)-3-(hydroxymethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 175981019 |
| Molecular Formula | C16H21BrF2N2O3 |
| Molecular Weight | 407.26 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | tert-butyl (3S)-4-(4-bromo-2,5-difluorophenyl)-3-(hydroxymethyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2cc(F)c(Br)cc2F)[C@H](CO)C1 |
| InChI | InChI=1S/C16H21BrF2N2O3/c1-16(2,3)24-15(23)20-4-5-21(10(8-20)9-22)14-7-12(18)11(17)6-13(14)19/h6-7,10,22H,4-5,8-9H2,1-3H3/t10-/m0/s1 |
| InChIKey | IMTDQQLCGZLMSL-JTQLQIEISA-N |
| XLogP | 3.15 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.26 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|