C12H25N3O3 — CID 118975150
tert-butyl (3S)-4-(2-aminoethyl)-3-(hydroxymethyl)piperazine-1-carboxylate (PubChem CID 118975150) has the molecular formula C12H25N3O3 and a molecular weight of 259.35 g/mol. Its IUPAC name is tert-butyl (3S)-4-(2-aminoethyl)-3-(hydroxymethyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl (3S)-4-(2-aminoethyl)-3-(hydroxymethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 118975150 |
| Molecular Formula | C12H25N3O3 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | tert-butyl (3S)-4-(2-aminoethyl)-3-(hydroxymethyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CCN)[C@H](CO)C1 |
| InChI | InChI=1S/C12H25N3O3/c1-12(2,3)18-11(17)15-7-6-14(5-4-13)10(8-15)9-16/h10,16H,4-9,13H2,1-3H3/t10-/m0/s1 |
| InChIKey | FZCGLUZELLOKAS-JTQLQIEISA-N |
| XLogP | -0.14 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |