C16H33N3O3 — CID 107703016
tert-butyl 3-(aminomethyl)-4-(6-hydroxyhexyl)piperazine-1-carboxylate (PubChem CID 107703016) has the molecular formula C16H33N3O3 and a molecular weight of 315.46 g/mol. Its IUPAC name is tert-butyl 3-(aminomethyl)-4-(6-hydroxyhexyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 3-(aminomethyl)-4-(6-hydroxyhexyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 107703016 |
| Molecular Formula | C16H33N3O3 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.25 |
| IUPAC Name | tert-butyl 3-(aminomethyl)-4-(6-hydroxyhexyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CCCCCCO)C(CN)C1 |
| InChI | InChI=1S/C16H33N3O3/c1-16(2,3)22-15(21)19-10-9-18(14(12-17)13-19)8-6-4-5-7-11-20/h14,20H,4-13,17H2,1-3H3 |
| InChIKey | RKHWRZBGCWIKGR-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|