C15H31N3O3 — CID 104647280
tert-butyl 3-(aminomethyl)-4-(4-methoxybutyl)piperazine-1-carboxylate (PubChem CID 104647280) has the molecular formula C15H31N3O3 and a molecular weight of 301.43 g/mol. Its IUPAC name is tert-butyl 3-(aminomethyl)-4-(4-methoxybutyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 3-(aminomethyl)-4-(4-methoxybutyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 104647280 |
| Molecular Formula | C15H31N3O3 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | tert-butyl 3-(aminomethyl)-4-(4-methoxybutyl)piperazine-1-carboxylate |
| SMILES | COCCCCN1CCN(C(=O)OC(C)(C)C)CC1CN |
| InChI | InChI=1S/C15H31N3O3/c1-15(2,3)21-14(19)18-9-8-17(13(11-16)12-18)7-5-6-10-20-4/h13H,5-12,16H2,1-4H3 |
| InChIKey | GCGLNWCFVAFOSB-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 68.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|