C12H21N3O2 — CID 134340317
tert-butyl (3S)-3-(cyanomethyl)-4-methylpiperazine-1-carboxylate (PubChem CID 134340317) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is tert-butyl (3S)-3-(cyanomethyl)-4-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-(cyanomethyl)-4-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 134340317 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | tert-butyl (3S)-3-(cyanomethyl)-4-methylpiperazine-1-carboxylate |
| SMILES | CN1CCN(C(=O)OC(C)(C)C)C[C@@H]1CC#N |
| InChI | InChI=1S/C12H21N3O2/c1-12(2,3)17-11(16)15-8-7-14(4)10(9-15)5-6-13/h10H,5,7-9H2,1-4H3/t10-/m0/s1 |
| InChIKey | LUSSZSLYCYMSFQ-JTQLQIEISA-N |
| XLogP | 1.45 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |