C16H33N3O4 — CID 103409239
tert-butyl 3-(aminomethyl)-4-[3-(2-methoxyethoxy)propyl]piperazine-1-carboxylate (PubChem CID 103409239) has the molecular formula C16H33N3O4 and a molecular weight of 331.46 g/mol. Its IUPAC name is tert-butyl 3-(aminomethyl)-4-[3-(2-methoxyethoxy)propyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 3-(aminomethyl)-4-[3-(2-methoxyethoxy)propyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 103409239 |
| Molecular Formula | C16H33N3O4 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.25 |
| IUPAC Name | tert-butyl 3-(aminomethyl)-4-[3-(2-methoxyethoxy)propyl]piperazine-1-carboxylate |
| SMILES | COCCOCCCN1CCN(C(=O)OC(C)(C)C)CC1CN |
| InChI | InChI=1S/C16H33N3O4/c1-16(2,3)23-15(20)19-8-7-18(14(12-17)13-19)6-5-9-22-11-10-21-4/h14H,5-13,17H2,1-4H3 |
| InChIKey | JAHJEBUOVMOALN-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 77.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|