C22H35N3O5 — CID 167118845
tert-butyl 3-(2-hydroxyethyl)-4-[3-(phenylmethoxycarbonylamino)propyl]piperazine-1-carboxylate (PubChem CID 167118845) has the molecular formula C22H35N3O5 and a molecular weight of 421.54 g/mol. Its IUPAC name is tert-butyl 3-(2-hydroxyethyl)-4-[3-(phenylmethoxycarbonylamino)propyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 3-(2-hydroxyethyl)-4-[3-(phenylmethoxycarbonylamino)propyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 167118845 |
| Molecular Formula | C22H35N3O5 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | tert-butyl 3-(2-hydroxyethyl)-4-[3-(phenylmethoxycarbonylamino)propyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CCCNC(=O)OCc2ccccc2)C(CCO)C1 |
| InChI | InChI=1S/C22H35N3O5/c1-22(2,3)30-21(28)25-14-13-24(19(16-25)10-15-26)12-7-11-23-20(27)29-17-18-8-5-4-6-9-18/h4-6,8-9,19,26H,7,10-17H2,1-3H3,(H,23,27) |
| InChIKey | NUPVLNNTGRRZPY-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|