C20H30N2O7S — CID 167020893
tert-butyl (3S)-3-(methylsulfonyloxymethyl)-4-(2-oxo-2-phenylmethoxyethyl)piperazine-1-carboxylate (PubChem CID 167020893) has the molecular formula C20H30N2O7S and a molecular weight of 442.53 g/mol. Its IUPAC name is tert-butyl (3S)-3-(methylsulfonyloxymethyl)-4-(2-oxo-2-phenylmethoxyethyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-(methylsulfonyloxymethyl)-4-(2-oxo-2-phenylmethoxyethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 167020893 |
| Molecular Formula | C20H30N2O7S |
| Molecular Weight | 442.53 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | tert-butyl (3S)-3-(methylsulfonyloxymethyl)-4-(2-oxo-2-phenylmethoxyethyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC(=O)OCc2ccccc2)[C@H](COS(C)(=O)=O)C1 |
| InChI | InChI=1S/C20H30N2O7S/c1-20(2,3)29-19(24)22-11-10-21(17(12-22)15-28-30(4,25)26)13-18(23)27-14-16-8-6-5-7-9-16/h5-9,17H,10-15H2,1-4H3/t17-/m0/s1 |
| InChIKey | NILOVVKCOQQWKS-KRWDZBQOSA-N |
| XLogP | 1.63 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.53 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|