C24H37N3O7 — CID 142005002
benzyl 2-formamidoacetate;ditert-butyl piperazine-1,4-dicarboxylate (PubChem CID 142005002) has the molecular formula C24H37N3O7 and a molecular weight of 479.57 g/mol. Its IUPAC name is benzyl 2-formamidoacetate;ditert-butyl piperazine-1,4-dicarboxylate.
| Compound Name | benzyl 2-formamidoacetate;ditert-butyl piperazine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 142005002 |
| Molecular Formula | C24H37N3O7 |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | benzyl 2-formamidoacetate;ditert-butyl piperazine-1,4-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)OC(C)(C)C)CC1.O=CNCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H26N2O4.C10H11NO3/c1-13(2,3)19-11(17)15-7-9-16(10-8-15)12(18)20-14(4,5)6;12-8-11-6-10(13)14-7-9-4-2-1-3-5-9/h7-10H2,1-6H3;1-5,8H,6-7H2,(H,11,12) |
| InChIKey | YTXCZONBSSNGOH-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|