C22H33N3O6 — CID 166449818
tert-butyl 3-(hydroxymethyl)-4-[4-(phenylmethoxycarbonylamino)butanoyl]piperazine-1-carboxylate (PubChem CID 166449818) has the molecular formula C22H33N3O6 and a molecular weight of 435.52 g/mol. Its IUPAC name is tert-butyl 3-(hydroxymethyl)-4-[4-(phenylmethoxycarbonylamino)butanoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 3-(hydroxymethyl)-4-[4-(phenylmethoxycarbonylamino)butanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 166449818 |
| Molecular Formula | C22H33N3O6 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | tert-butyl 3-(hydroxymethyl)-4-[4-(phenylmethoxycarbonylamino)butanoyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)CCCNC(=O)OCc2ccccc2)C(CO)C1 |
| InChI | InChI=1S/C22H33N3O6/c1-22(2,3)31-21(29)24-12-13-25(18(14-24)15-26)19(27)10-7-11-23-20(28)30-16-17-8-5-4-6-9-17/h4-6,8-9,18,26H,7,10-16H2,1-3H3,(H,23,28) |
| InChIKey | ZCXRCYMMVVMWCZ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|