C29H42N2O5Si — CID 171779093
tert-butyl 4-[3-[tert-butyl(diphenyl)silyl]oxypropanoyl]-3-(hydroxymethyl)piperazine-1-carboxylate (PubChem CID 171779093) has the molecular formula C29H42N2O5Si and a molecular weight of 526.75 g/mol. Its IUPAC name is tert-butyl 4-[3-[tert-butyl(diphenyl)silyl]oxypropanoyl]-3-(hydroxymethyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[tert-butyl(diphenyl)silyl]oxypropanoyl]-3-(hydroxymethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 171779093 |
| Molecular Formula | C29H42N2O5Si |
| Molecular Weight | 526.75 g/mol |
| Exact Mass | 526.29 |
| IUPAC Name | tert-butyl 4-[3-[tert-butyl(diphenyl)silyl]oxypropanoyl]-3-(hydroxymethyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C(CO)C1 |
| InChI | InChI=1S/C29H42N2O5Si/c1-28(2,3)36-27(34)30-18-19-31(23(21-30)22-32)26(33)17-20-35-37(29(4,5)6,24-13-9-7-10-14-24)25-15-11-8-12-16-25/h7-16,23,32H,17-22H2,1-6H3 |
| InChIKey | SDONTNCWQGUORF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.75 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|