C32H48N2O4Si — CID 171779089
tert-butyl 2-tert-butyl-3-[3-[tert-butyl(diphenyl)silyl]oxypropanoyl]piperazine-1-carboxylate (PubChem CID 171779089) has the molecular formula C32H48N2O4Si and a molecular weight of 552.83 g/mol. Its IUPAC name is tert-butyl 2-tert-butyl-3-[3-[tert-butyl(diphenyl)silyl]oxypropanoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 2-tert-butyl-3-[3-[tert-butyl(diphenyl)silyl]oxypropanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 171779089 |
| Molecular Formula | C32H48N2O4Si |
| Molecular Weight | 552.83 g/mol |
| Exact Mass | 552.34 |
| IUPAC Name | tert-butyl 2-tert-butyl-3-[3-[tert-butyl(diphenyl)silyl]oxypropanoyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCNC(C(=O)CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1C(C)(C)C |
| InChI | InChI=1S/C32H48N2O4Si/c1-30(2,3)28-27(33-21-22-34(28)29(36)38-31(4,5)6)26(35)20-23-37-39(32(7,8)9,24-16-12-10-13-17-24)25-18-14-11-15-19-25/h10-19,27-28,33H,20-23H2,1-9H3 |
| InChIKey | PSDINTZGCUVSGZ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.83 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|