C33H44N2O3Si — CID 21077233
tert-butyl 2-[[3-[tert-butyl(diphenyl)silyl]oxy-4-methylphenyl]methyl]piperazine-1-carboxylate (PubChem CID 21077233) has the molecular formula C33H44N2O3Si and a molecular weight of 544.81 g/mol. Its IUPAC name is tert-butyl 2-[[3-[tert-butyl(diphenyl)silyl]oxy-4-methylphenyl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 2-[[3-[tert-butyl(diphenyl)silyl]oxy-4-methylphenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 21077233 |
| Molecular Formula | C33H44N2O3Si |
| Molecular Weight | 544.81 g/mol |
| Exact Mass | 544.31 |
| IUPAC Name | tert-butyl 2-[[3-[tert-butyl(diphenyl)silyl]oxy-4-methylphenyl]methyl]piperazine-1-carboxylate |
| SMILES | Cc1ccc(CC2CNCCN2C(=O)OC(C)(C)C)cc1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C33H44N2O3Si/c1-25-18-19-26(22-27-24-34-20-21-35(27)31(36)37-32(2,3)4)23-30(25)38-39(33(5,6)7,28-14-10-8-11-15-28)29-16-12-9-13-17-29/h8-19,23,27,34H,20-22,24H2,1-7H3 |
| InChIKey | APACNZGEAGXTDP-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.81 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|