C22H37ClN2O3Si — CID 69422296
tert-butyl (2R)-2-[[3-[tert-butyl(dimethyl)silyl]oxy-4-chlorophenyl]methyl]piperazine-1-carboxylate (PubChem CID 69422296) has the molecular formula C22H37ClN2O3Si and a molecular weight of 441.09 g/mol. Its IUPAC name is tert-butyl (2R)-2-[[3-[tert-butyl(dimethyl)silyl]oxy-4-chlorophenyl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[[3-[tert-butyl(dimethyl)silyl]oxy-4-chlorophenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 69422296 |
| Molecular Formula | C22H37ClN2O3Si |
| Molecular Weight | 441.09 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | tert-butyl (2R)-2-[[3-[tert-butyl(dimethyl)silyl]oxy-4-chlorophenyl]methyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCNC[C@H]1Cc1ccc(Cl)c(O[Si](C)(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C22H37ClN2O3Si/c1-21(2,3)27-20(26)25-12-11-24-15-17(25)13-16-9-10-18(23)19(14-16)28-29(7,8)22(4,5)6/h9-10,14,17,24H,11-13,15H2,1-8H3/t17-/m1/s1 |
| InChIKey | GUZBJCSAXDFWFS-QGZVFWFLSA-N |
| XLogP | 5.48 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.09 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|