C18H24ClN3O2 — CID 175814346
tert-butyl 2-[(5-chloro-1H-indol-2-yl)methyl]piperazine-1-carboxylate (PubChem CID 175814346) has the molecular formula C18H24ClN3O2 and a molecular weight of 349.86 g/mol. Its IUPAC name is tert-butyl 2-[(5-chloro-1H-indol-2-yl)methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 2-[(5-chloro-1H-indol-2-yl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 175814346 |
| Molecular Formula | C18H24ClN3O2 |
| Molecular Weight | 349.86 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | tert-butyl 2-[(5-chloro-1H-indol-2-yl)methyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCNCC1Cc1cc2cc(Cl)ccc2[nH]1 |
| InChI | InChI=1S/C18H24ClN3O2/c1-18(2,3)24-17(23)22-7-6-20-11-15(22)10-14-9-12-8-13(19)4-5-16(12)21-14/h4-5,8-9,15,20-21H,6-7,10-11H2,1-3H3 |
| InChIKey | HLLMBUZNTAZILF-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.86 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |