C17H23F3N2O3 — CID 177207047
tert-butyl (2S)-2-[[3-(trifluoromethyl)phenoxy]methyl]piperazine-1-carboxylate (PubChem CID 177207047) has the molecular formula C17H23F3N2O3 and a molecular weight of 360.38 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[3-(trifluoromethyl)phenoxy]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[[3-(trifluoromethyl)phenoxy]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 177207047 |
| Molecular Formula | C17H23F3N2O3 |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | tert-butyl (2S)-2-[[3-(trifluoromethyl)phenoxy]methyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCNC[C@H]1COc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H23F3N2O3/c1-16(2,3)25-15(23)22-8-7-21-10-13(22)11-24-14-6-4-5-12(9-14)17(18,19)20/h4-6,9,13,21H,7-8,10-11H2,1-3H3/t13-/m0/s1 |
| InChIKey | GDBOLFAYAIDZGD-ZDUSSCGKSA-N |
| XLogP | 3.29 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |