C17H26N2O3 — CID 54425425
tert-butyl (2R)-2-[(3-hydroxy-4-methylphenyl)methyl]piperazine-1-carboxylate (PubChem CID 54425425) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(3-hydroxy-4-methylphenyl)methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[(3-hydroxy-4-methylphenyl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 54425425 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | tert-butyl (2R)-2-[(3-hydroxy-4-methylphenyl)methyl]piperazine-1-carboxylate |
| SMILES | Cc1ccc(C[C@@H]2CNCCN2C(=O)OC(C)(C)C)cc1O |
| InChI | InChI=1S/C17H26N2O3/c1-12-5-6-13(10-15(12)20)9-14-11-18-7-8-19(14)16(21)22-17(2,3)4/h5-6,10,14,18,20H,7-9,11H2,1-4H3/t14-/m1/s1 |
| InChIKey | WDSVIRKLXNHXRK-CQSZACIVSA-N |
| XLogP | 2.45 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |