C33H43NO4Si — CID 140904839
tert-butyl (2S,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(phenylmethoxymethyl)azetidine-1-carboxylate (PubChem CID 140904839) has the molecular formula C33H43NO4Si and a molecular weight of 545.80 g/mol. Its IUPAC name is tert-butyl (2S,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(phenylmethoxymethyl)azetidine-1-carboxylate.
| Compound Name | tert-butyl (2S,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(phenylmethoxymethyl)azetidine-1-carboxylate |
|---|---|
| PubChem CID | 140904839 |
| Molecular Formula | C33H43NO4Si |
| Molecular Weight | 545.80 g/mol |
| Exact Mass | 545.30 |
| IUPAC Name | tert-butyl (2S,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(phenylmethoxymethyl)azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](COCc2ccccc2)[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C33H43NO4Si/c1-32(2,3)38-31(35)34-22-27(24-36-23-26-16-10-7-11-17-26)30(34)25-37-39(33(4,5)6,28-18-12-8-13-19-28)29-20-14-9-15-21-29/h7-21,27,30H,22-25H2,1-6H3/t27-,30-/m1/s1 |
| InChIKey | MRGOPCVBIXCGBL-POURPWNDSA-N |
| XLogP | 6.02 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.80 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|