C34H43NO7Si — CID 11444843
tert-butyl (2R,3S,4S,5S)-3-benzoyloxy-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-dihydroxypiperidine-1-carboxylate (PubChem CID 11444843) has the molecular formula C34H43NO7Si and a molecular weight of 605.80 g/mol. Its IUPAC name is tert-butyl (2R,3S,4S,5S)-3-benzoyloxy-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-dihydroxypiperidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3S,4S,5S)-3-benzoyloxy-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-dihydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 11444843 |
| Molecular Formula | C34H43NO7Si |
| Molecular Weight | 605.80 g/mol |
| Exact Mass | 605.28 |
| IUPAC Name | tert-butyl (2R,3S,4S,5S)-3-benzoyloxy-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-dihydroxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](O)[C@H](O)[C@@H](OC(=O)c2ccccc2)[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C34H43NO7Si/c1-33(2,3)42-32(39)35-22-28(36)29(37)30(41-31(38)24-16-10-7-11-17-24)27(35)23-40-43(34(4,5)6,25-18-12-8-13-19-25)26-20-14-9-15-21-26/h7-21,27-30,36-37H,22-23H2,1-6H3/t27-,28+,29+,30+/m1/s1 |
| InChIKey | DGBUQYZTAOLQAG-RYTSNQFKSA-N |
| XLogP | 4.13 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.80 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|