C33H52N2O6SSi — CID 15946512
tert-butyl 4-[2-[4-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylbutoxy]sulfonylethyl]piperazine-1-carboxylate (PubChem CID 15946512) has the molecular formula C33H52N2O6SSi and a molecular weight of 632.94 g/mol. Its IUPAC name is tert-butyl 4-[2-[4-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylbutoxy]sulfonylethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[4-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylbutoxy]sulfonylethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 15946512 |
| Molecular Formula | C33H52N2O6SSi |
| Molecular Weight | 632.94 g/mol |
| Exact Mass | 632.33 |
| IUPAC Name | tert-butyl 4-[2-[4-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylbutoxy]sulfonylethyl]piperazine-1-carboxylate |
| SMILES | CC(C)(CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)COS(=O)(=O)CCN1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C33H52N2O6SSi/c1-31(2,3)41-30(36)35-22-20-34(21-23-35)24-26-42(37,38)39-27-33(7,8)19-25-40-43(32(4,5)6,28-15-11-9-12-16-28)29-17-13-10-14-18-29/h9-18H,19-27H2,1-8H3 |
| InChIKey | GMAFPNDNYIWPPR-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.94 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|