C25H37BrN2OSi — CID 53423592
2-[4-(3-bromopropyl)piperazin-1-yl]ethoxy-tert-butyl-diphenylsilane (PubChem CID 53423592) has the molecular formula C25H37BrN2OSi and a molecular weight of 489.57 g/mol. Its IUPAC name is 2-[4-(3-bromopropyl)piperazin-1-yl]ethoxy-tert-butyl-diphenylsilane.
| Compound Name | 2-[4-(3-bromopropyl)piperazin-1-yl]ethoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 53423592 |
| Molecular Formula | C25H37BrN2OSi |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | 2-[4-(3-bromopropyl)piperazin-1-yl]ethoxy-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCCN1CCN(CCCBr)CC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H37BrN2OSi/c1-25(2,3)30(23-11-6-4-7-12-23,24-13-8-5-9-14-24)29-22-21-28-19-17-27(18-20-28)16-10-15-26/h4-9,11-14H,10,15-22H2,1-3H3 |
| InChIKey | WKSPEURDHKILJW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|