C30H38F3N3OSi — CID 165404222
4-[[4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]piperazin-1-yl]methyl]-3-(trifluoromethyl)aniline (PubChem CID 165404222) has the molecular formula C30H38F3N3OSi and a molecular weight of 541.73 g/mol. Its IUPAC name is 4-[[4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]piperazin-1-yl]methyl]-3-(trifluoromethyl)aniline.
| Compound Name | 4-[[4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]piperazin-1-yl]methyl]-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 165404222 |
| Molecular Formula | C30H38F3N3OSi |
| Molecular Weight | 541.73 g/mol |
| Exact Mass | 541.27 |
| IUPAC Name | 4-[[4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]piperazin-1-yl]methyl]-3-(trifluoromethyl)aniline |
| SMILES | CC(C)(C)[Si](OCCN1CCN(Cc2ccc(N)cc2C(F)(F)F)CC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H38F3N3OSi/c1-29(2,3)38(26-10-6-4-7-11-26,27-12-8-5-9-13-27)37-21-20-35-16-18-36(19-17-35)23-24-14-15-25(34)22-28(24)30(31,32)33/h4-15,22H,16-21,23,34H2,1-3H3 |
| InChIKey | BJPOEVICVQZADT-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.73 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|