C15H20F3N3O4S — CID 165404239
1-(2-methylsulfonylethyl)-4-[[4-nitro-2-(trifluoromethyl)phenyl]methyl]piperazine (PubChem CID 165404239) has the molecular formula C15H20F3N3O4S and a molecular weight of 395.40 g/mol. Its IUPAC name is 1-(2-methylsulfonylethyl)-4-[[4-nitro-2-(trifluoromethyl)phenyl]methyl]piperazine.
| Compound Name | 1-(2-methylsulfonylethyl)-4-[[4-nitro-2-(trifluoromethyl)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 165404239 |
| Molecular Formula | C15H20F3N3O4S |
| Molecular Weight | 395.40 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 1-(2-methylsulfonylethyl)-4-[[4-nitro-2-(trifluoromethyl)phenyl]methyl]piperazine |
| SMILES | CS(=O)(=O)CCN1CCN(Cc2ccc([N+](=O)[O-])cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H20F3N3O4S/c1-26(24,25)9-8-19-4-6-20(7-5-19)11-12-2-3-13(21(22)23)10-14(12)15(16,17)18/h2-3,10H,4-9,11H2,1H3 |
| InChIKey | SMXHNIORWUSHTC-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.40 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|