C13H16F3N3O4S — CID 165404148
1-methylsulfonyl-4-[[4-nitro-2-(trifluoromethyl)phenyl]methyl]piperazine (PubChem CID 165404148) has the molecular formula C13H16F3N3O4S and a molecular weight of 367.35 g/mol. Its IUPAC name is 1-methylsulfonyl-4-[[4-nitro-2-(trifluoromethyl)phenyl]methyl]piperazine.
| Compound Name | 1-methylsulfonyl-4-[[4-nitro-2-(trifluoromethyl)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 165404148 |
| Molecular Formula | C13H16F3N3O4S |
| Molecular Weight | 367.35 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 1-methylsulfonyl-4-[[4-nitro-2-(trifluoromethyl)phenyl]methyl]piperazine |
| SMILES | CS(=O)(=O)N1CCN(Cc2ccc([N+](=O)[O-])cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H16F3N3O4S/c1-24(22,23)18-6-4-17(5-7-18)9-10-2-3-11(19(20)21)8-12(10)13(14,15)16/h2-3,8H,4-7,9H2,1H3 |
| InChIKey | UQOPKWXHQYESGM-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|