C14H16F5N3O2 — CID 22249267
1-methyl-4-[[5-nitro-2-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]piperazine (PubChem CID 22249267) has the molecular formula C14H16F5N3O2 and a molecular weight of 353.29 g/mol. Its IUPAC name is 1-methyl-4-[[5-nitro-2-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]piperazine.
| Compound Name | 1-methyl-4-[[5-nitro-2-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 22249267 |
| Molecular Formula | C14H16F5N3O2 |
| Molecular Weight | 353.29 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 1-methyl-4-[[5-nitro-2-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]piperazine |
| SMILES | CN1CCN(Cc2cc([N+](=O)[O-])ccc2C(F)(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H16F5N3O2/c1-20-4-6-21(7-5-20)9-10-8-11(22(23)24)2-3-12(10)13(15,16)14(17,18)19/h2-3,8H,4-7,9H2,1H3 |
| InChIKey | UYRKJZKJTUDTIP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.29 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|