C29H32F10N4O6 — CID 87960527
1-methyl-4-[[5-nitro-2-(1,1,2,2,2-pentafluoroethyl)phenoxy]methyl]piperidine;4-[[5-nitro-2-(1,1,2,2,2-pentafluoroethyl)phenoxy]methyl]piperidine (PubChem CID 87960527) has the molecular formula C29H32F10N4O6 and a molecular weight of 722.58 g/mol. Its IUPAC name is 1-methyl-4-[[5-nitro-2-(1,1,2,2,2-pentafluoroethyl)phenoxy]methyl]piperidine;4-[[5-nitro-2-(1,1,2,2,2-pentafluoroethyl)phenoxy]methyl]piperidine.
| Compound Name | 1-methyl-4-[[5-nitro-2-(1,1,2,2,2-pentafluoroethyl)phenoxy]methyl]piperidine;4-[[5-nitro-2-(1,1,2,2,2-pentafluoroethyl)phenoxy]methyl]piperidine |
|---|---|
| PubChem CID | 87960527 |
| Molecular Formula | C29H32F10N4O6 |
| Molecular Weight | 722.58 g/mol |
| Exact Mass | 722.22 |
| IUPAC Name | 1-methyl-4-[[5-nitro-2-(1,1,2,2,2-pentafluoroethyl)phenoxy]methyl]piperidine;4-[[5-nitro-2-(1,1,2,2,2-pentafluoroethyl)phenoxy]methyl]piperidine |
| SMILES | CN1CCC(COc2cc([N+](=O)[O-])ccc2C(F)(F)C(F)(F)F)CC1.O=[N+]([O-])c1ccc(C(F)(F)C(F)(F)F)c(OCC2CCNCC2)c1 |
| InChI | InChI=1S/C15H17F5N2O3.C14H15F5N2O3/c1-21-6-4-10(5-7-21)9-25-13-8-11(22(23)24)2-3-12(13)14(16,17)15(18,19)20;15-13(16,14(17,18)19)11-2-1-10(21(22)23)7-12(11)24-8-9-3-5-20-6-4-9/h2-3,8,10H,4-7,9H2,1H3;1-2,7,9,20H,3-6,8H2 |
| InChIKey | MDXSJEDFMYLFEQ-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 120.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.58 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|