C28H30F10N4O6 — CID 159628781
4-[[5-nitro-2-(1,1,2,2,2-pentafluoroethyl)phenoxy]methyl]piperidine (PubChem CID 159628781) has the molecular formula C28H30F10N4O6 and a molecular weight of 708.55 g/mol. Its IUPAC name is 4-[[5-nitro-2-(1,1,2,2,2-pentafluoroethyl)phenoxy]methyl]piperidine.
| Compound Name | 4-[[5-nitro-2-(1,1,2,2,2-pentafluoroethyl)phenoxy]methyl]piperidine |
|---|---|
| PubChem CID | 159628781 |
| Molecular Formula | C28H30F10N4O6 |
| Molecular Weight | 708.55 g/mol |
| Exact Mass | 708.20 |
| IUPAC Name | 4-[[5-nitro-2-(1,1,2,2,2-pentafluoroethyl)phenoxy]methyl]piperidine |
| SMILES | O=[N+]([O-])c1ccc(C(F)(F)C(F)(F)F)c(OCC2CCNCC2)c1.O=[N+]([O-])c1ccc(C(F)(F)C(F)(F)F)c(OCC2CCNCC2)c1 |
| InChI | InChI=1S/2C14H15F5N2O3/c2*15-13(16,14(17,18)19)11-2-1-10(21(22)23)7-12(11)24-8-9-3-5-20-6-4-9/h2*1-2,7,9,20H,3-6,8H2 |
| InChIKey | MOVRHGMJXYGZNK-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 128.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.55 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|