C14H15F5N2O3 — CID 87784069
(2S)-1-methyl-2-[[5-nitro-2-(1,1,2,2,2-pentafluoroethyl)phenoxy]methyl]pyrrolidine (PubChem CID 87784069) has the molecular formula C14H15F5N2O3 and a molecular weight of 354.28 g/mol. Its IUPAC name is (2S)-1-methyl-2-[[5-nitro-2-(1,1,2,2,2-pentafluoroethyl)phenoxy]methyl]pyrrolidine.
| Compound Name | (2S)-1-methyl-2-[[5-nitro-2-(1,1,2,2,2-pentafluoroethyl)phenoxy]methyl]pyrrolidine |
|---|---|
| PubChem CID | 87784069 |
| Molecular Formula | C14H15F5N2O3 |
| Molecular Weight | 354.28 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | (2S)-1-methyl-2-[[5-nitro-2-(1,1,2,2,2-pentafluoroethyl)phenoxy]methyl]pyrrolidine |
| SMILES | CN1CCC[C@H]1COc1cc([N+](=O)[O-])ccc1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H15F5N2O3/c1-20-6-2-3-10(20)8-24-12-7-9(21(22)23)4-5-11(12)13(15,16)14(17,18)19/h4-5,7,10H,2-3,6,8H2,1H3/t10-/m0/s1 |
| InChIKey | GKTSLPFJLUCXQX-JTQLQIEISA-N |
| XLogP | 3.72 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.28 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|