C14H15F5N2O3 — CID 123182921
(2S)-2-[[5-amino-2-(1,1,2,2,2-pentafluoroethyl)phenoxy]methyl]pyrrolidine-1-carboxylic acid (PubChem CID 123182921) has the molecular formula C14H15F5N2O3 and a molecular weight of 354.28 g/mol. Its IUPAC name is (2S)-2-[[5-amino-2-(1,1,2,2,2-pentafluoroethyl)phenoxy]methyl]pyrrolidine-1-carboxylic acid.
| Compound Name | (2S)-2-[[5-amino-2-(1,1,2,2,2-pentafluoroethyl)phenoxy]methyl]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 123182921 |
| Molecular Formula | C14H15F5N2O3 |
| Molecular Weight | 354.28 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | (2S)-2-[[5-amino-2-(1,1,2,2,2-pentafluoroethyl)phenoxy]methyl]pyrrolidine-1-carboxylic acid |
| SMILES | Nc1ccc(C(F)(F)C(F)(F)F)c(OC[C@@H]2CCCN2C(=O)O)c1 |
| InChI | InChI=1S/C14H15F5N2O3/c15-13(16,14(17,18)19)10-4-3-8(20)6-11(10)24-7-9-2-1-5-21(9)12(22)23/h3-4,6,9H,1-2,5,7,20H2,(H,22,23)/t9-/m0/s1 |
| InChIKey | XIGUHQREISUXQR-VIFPVBQESA-N |
| XLogP | 3.44 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.28 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|