C19H24F6N2O3 — CID 86588701
tert-butyl 2-[[2-(3-aminophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]oxymethyl]pyrrolidine-1-carboxylate (PubChem CID 86588701) has the molecular formula C19H24F6N2O3 and a molecular weight of 442.40 g/mol. Its IUPAC name is tert-butyl 2-[[2-(3-aminophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]oxymethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[2-(3-aminophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]oxymethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 86588701 |
| Molecular Formula | C19H24F6N2O3 |
| Molecular Weight | 442.40 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | tert-butyl 2-[[2-(3-aminophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]oxymethyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1COC(c1cccc(N)c1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C19H24F6N2O3/c1-16(2,3)30-15(28)27-9-5-8-14(27)11-29-17(18(20,21)22,19(23,24)25)12-6-4-7-13(26)10-12/h4,6-7,10,14H,5,8-9,11,26H2,1-3H3 |
| InChIKey | LQHKTXTXIKKEBW-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.40 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|