C30H32F5N5O4 — CID 87108248
tert-butyl (2S)-2-[[2-(1,1,2,2,2-pentafluoroethyl)-5-[[2-(pyridin-4-ylmethylamino)pyridine-3-carbonyl]amino]phenoxy]methyl]pyrrolidine-1-carboxylate (PubChem CID 87108248) has the molecular formula C30H32F5N5O4 and a molecular weight of 621.61 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[2-(1,1,2,2,2-pentafluoroethyl)-5-[[2-(pyridin-4-ylmethylamino)pyridine-3-carbonyl]amino]phenoxy]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[[2-(1,1,2,2,2-pentafluoroethyl)-5-[[2-(pyridin-4-ylmethylamino)pyridine-3-carbonyl]amino]phenoxy]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 87108248 |
| Molecular Formula | C30H32F5N5O4 |
| Molecular Weight | 621.61 g/mol |
| Exact Mass | 621.24 |
| IUPAC Name | tert-butyl (2S)-2-[[2-(1,1,2,2,2-pentafluoroethyl)-5-[[2-(pyridin-4-ylmethylamino)pyridine-3-carbonyl]amino]phenoxy]methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1COc1cc(NC(=O)c2cccnc2NCc2ccncc2)ccc1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C30H32F5N5O4/c1-28(2,3)44-27(42)40-15-5-6-21(40)18-43-24-16-20(8-9-23(24)29(31,32)30(33,34)35)39-26(41)22-7-4-12-37-25(22)38-17-19-10-13-36-14-11-19/h4,7-14,16,21H,5-6,15,17-18H2,1-3H3,(H,37,38)(H,39,41)/t21-/m0/s1 |
| InChIKey | NIKQRARLBRMZAI-NRFANRHFSA-N |
| XLogP | 6.77 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.61 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|