C28H27F5N4O3 — CID 59997005
2-(2,3-dihydro-1-benzofuran-5-ylmethylamino)-N-[4-(1,1,2,2,2-pentafluoroethyl)-3-[[(2S)-pyrrolidin-2-yl]methoxy]phenyl]pyridine-3-carboxamide (PubChem CID 59997005) has the molecular formula C28H27F5N4O3 and a molecular weight of 562.54 g/mol. Its IUPAC name is 2-(2,3-dihydro-1-benzofuran-5-ylmethylamino)-N-[4-(1,1,2,2,2-pentafluoroethyl)-3-[[(2S)-pyrrolidin-2-yl]methoxy]phenyl]pyridine-3-carboxamide.
| Compound Name | 2-(2,3-dihydro-1-benzofuran-5-ylmethylamino)-N-[4-(1,1,2,2,2-pentafluoroethyl)-3-[[(2S)-pyrrolidin-2-yl]methoxy]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 59997005 |
| Molecular Formula | C28H27F5N4O3 |
| Molecular Weight | 562.54 g/mol |
| Exact Mass | 562.20 |
| IUPAC Name | 2-(2,3-dihydro-1-benzofuran-5-ylmethylamino)-N-[4-(1,1,2,2,2-pentafluoroethyl)-3-[[(2S)-pyrrolidin-2-yl]methoxy]phenyl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(C(F)(F)C(F)(F)F)c(OC[C@@H]2CCCN2)c1)c1cccnc1NCc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C28H27F5N4O3/c29-27(30,28(31,32)33)22-7-6-19(14-24(22)40-16-20-3-1-10-34-20)37-26(38)21-4-2-11-35-25(21)36-15-17-5-8-23-18(13-17)9-12-39-23/h2,4-8,11,13-14,20,34H,1,3,9-10,12,15-16H2,(H,35,36)(H,37,38)/t20-/m0/s1 |
| InChIKey | CVAHWSDWYNWHFU-FQEVSTJZSA-N |
| XLogP | 5.67 |
| TPSA | 84.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.54 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|