C28H26F5N5O3 — CID 90983226
2-[(1-hydroxy-2H-isoindol-4-yl)amino]-N-[3-[[(2R)-1-methylpyrrolidin-2-yl]methoxy]-4-(1,1,2,2,2-pentafluoroethyl)phenyl]pyridine-3-carboxamide (PubChem CID 90983226) has the molecular formula C28H26F5N5O3 and a molecular weight of 575.54 g/mol. Its IUPAC name is 2-[(1-hydroxy-2H-isoindol-4-yl)amino]-N-[3-[[(2R)-1-methylpyrrolidin-2-yl]methoxy]-4-(1,1,2,2,2-pentafluoroethyl)phenyl]pyridine-3-carboxamide.
| Compound Name | 2-[(1-hydroxy-2H-isoindol-4-yl)amino]-N-[3-[[(2R)-1-methylpyrrolidin-2-yl]methoxy]-4-(1,1,2,2,2-pentafluoroethyl)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 90983226 |
| Molecular Formula | C28H26F5N5O3 |
| Molecular Weight | 575.54 g/mol |
| Exact Mass | 575.20 |
| IUPAC Name | 2-[(1-hydroxy-2H-isoindol-4-yl)amino]-N-[3-[[(2R)-1-methylpyrrolidin-2-yl]methoxy]-4-(1,1,2,2,2-pentafluoroethyl)phenyl]pyridine-3-carboxamide |
| SMILES | CN1CCC[C@@H]1COc1cc(NC(=O)c2cccnc2Nc2cccc3c(O)[nH]cc23)ccc1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C28H26F5N5O3/c1-38-12-4-5-17(38)15-41-23-13-16(9-10-21(23)27(29,30)28(31,32)33)36-26(40)19-7-3-11-34-24(19)37-22-8-2-6-18-20(22)14-35-25(18)39/h2-3,6-11,13-14,17,35,39H,4-5,12,15H2,1H3,(H,34,37)(H,36,40)/t17-/m1/s1 |
| InChIKey | VKRGJDDMFJEAME-QGZVFWFLSA-N |
| XLogP | 6.39 |
| TPSA | 102.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.54 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|