C21H21ClF5N3O3 — CID 87620615
2-chloro-N-[3-[(2S)-2-hydroxy-3-pyrrolidin-1-ylpropoxy]-4-(1,1,2,2,2-pentafluoroethyl)phenyl]pyridine-3-carboxamide (PubChem CID 87620615) has the molecular formula C21H21ClF5N3O3 and a molecular weight of 493.86 g/mol. Its IUPAC name is 2-chloro-N-[3-[(2S)-2-hydroxy-3-pyrrolidin-1-ylpropoxy]-4-(1,1,2,2,2-pentafluoroethyl)phenyl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[3-[(2S)-2-hydroxy-3-pyrrolidin-1-ylpropoxy]-4-(1,1,2,2,2-pentafluoroethyl)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 87620615 |
| Molecular Formula | C21H21ClF5N3O3 |
| Molecular Weight | 493.86 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | 2-chloro-N-[3-[(2S)-2-hydroxy-3-pyrrolidin-1-ylpropoxy]-4-(1,1,2,2,2-pentafluoroethyl)phenyl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(C(F)(F)C(F)(F)F)c(OC[C@@H](O)CN2CCCC2)c1)c1cccnc1Cl |
| InChI | InChI=1S/C21H21ClF5N3O3/c22-18-15(4-3-7-28-18)19(32)29-13-5-6-16(20(23,24)21(25,26)27)17(10-13)33-12-14(31)11-30-8-1-2-9-30/h3-7,10,14,31H,1-2,8-9,11-12H2,(H,29,32)/t14-/m0/s1 |
| InChIKey | ZTYZAMAOXVKOST-AWEZNQCLSA-N |
| XLogP | 4.48 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.86 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|