C15H20ClN3O4 — CID 87474648
3-[(2-hydroxy-3-piperidin-1-ylpropoxy)carbamoyl]pyridine-2-carbonyl chloride (PubChem CID 87474648) has the molecular formula C15H20ClN3O4 and a molecular weight of 341.80 g/mol. Its IUPAC name is 3-[(2-hydroxy-3-piperidin-1-ylpropoxy)carbamoyl]pyridine-2-carbonyl chloride.
| Compound Name | 3-[(2-hydroxy-3-piperidin-1-ylpropoxy)carbamoyl]pyridine-2-carbonyl chloride |
|---|---|
| PubChem CID | 87474648 |
| Molecular Formula | C15H20ClN3O4 |
| Molecular Weight | 341.80 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 3-[(2-hydroxy-3-piperidin-1-ylpropoxy)carbamoyl]pyridine-2-carbonyl chloride |
| SMILES | O=C(NOCC(O)CN1CCCCC1)c1cccnc1C(=O)Cl |
| InChI | InChI=1S/C15H20ClN3O4/c16-14(21)13-12(5-4-6-17-13)15(22)18-23-10-11(20)9-19-7-2-1-3-8-19/h4-6,11,20H,1-3,7-10H2,(H,18,22) |
| InChIKey | WIUADEPTKLBGJD-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.80 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|