C17H28N4O2 — CID 18766181
3-(2-hydroxy-3-piperidin-1-ylpropoxy)-1,1-dimethyl-2-phenylguanidine (PubChem CID 18766181) has the molecular formula C17H28N4O2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 3-(2-hydroxy-3-piperidin-1-ylpropoxy)-1,1-dimethyl-2-phenylguanidine.
| Compound Name | 3-(2-hydroxy-3-piperidin-1-ylpropoxy)-1,1-dimethyl-2-phenylguanidine |
|---|---|
| PubChem CID | 18766181 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 3-(2-hydroxy-3-piperidin-1-ylpropoxy)-1,1-dimethyl-2-phenylguanidine |
| SMILES | CN(C)/C(=N\c1ccccc1)NOCC(O)CN1CCCCC1 |
| InChI | InChI=1S/C17H28N4O2/c1-20(2)17(18-15-9-5-3-6-10-15)19-23-14-16(22)13-21-11-7-4-8-12-21/h3,5-6,9-10,16,22H,4,7-8,11-14H2,1-2H3,(H,18,19) |
| InChIKey | YGEJFAQGOWPRNW-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|